C18H20Cl2N2O3S2 — CID 26872241
1-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-4-thiophen-2-ylbutan-1-one (PubChem CID 26872241) has the molecular formula C18H20Cl2N2O3S2 and a molecular weight of 447.41 g/mol. Its IUPAC name is 1-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 26872241 |
| Molecular Formula | C18H20Cl2N2O3S2 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 1-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-4-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCc1cccs1)N1CCN(S(=O)(=O)c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C18H20Cl2N2O3S2/c19-15-6-2-7-16(18(15)20)27(24,25)22-11-9-21(10-12-22)17(23)8-1-4-14-5-3-13-26-14/h2-3,5-7,13H,1,4,8-12H2 |
| InChIKey | JGEFIXCWQCHGAM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |