C22H30N2O3S2 — CID 112794619
1-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-4-thiophen-2-ylbutan-1-one (PubChem CID 112794619) has the molecular formula C22H30N2O3S2 and a molecular weight of 434.63 g/mol. Its IUPAC name is 1-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 112794619 |
| Molecular Formula | C22H30N2O3S2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 1-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]-4-thiophen-2-ylbutan-1-one |
| SMILES | CCC(C)c1ccc(S(=O)(=O)N2CCN(C(=O)CCCc3cccs3)CC2)cc1 |
| InChI | InChI=1S/C22H30N2O3S2/c1-3-18(2)19-9-11-21(12-10-19)29(26,27)24-15-13-23(14-16-24)22(25)8-4-6-20-7-5-17-28-20/h5,7,9-12,17-18H,3-4,6,8,13-16H2,1-2H3 |
| InChIKey | UYZVTPVXAJCJLX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |