C22H24N2O3S2 — CID 17461875
1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-4-thiophen-2-ylbutan-1-one (PubChem CID 17461875) has the molecular formula C22H24N2O3S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 17461875 |
| Molecular Formula | C22H24N2O3S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-4-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCc1cccs1)N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C22H24N2O3S2/c25-22(9-3-7-20-8-4-16-28-20)23-12-14-24(15-13-23)29(26,27)21-11-10-18-5-1-2-6-19(18)17-21/h1-2,4-6,8,10-11,16-17H,3,7,9,12-15H2 |
| InChIKey | OAKYPTVTJUDQRQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |