C22H25N3O3S2 — CID 112769581
1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-(1-thiophen-2-ylethylamino)ethanone (PubChem CID 112769581) has the molecular formula C22H25N3O3S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-(1-thiophen-2-ylethylamino)ethanone.
| Compound Name | 1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-(1-thiophen-2-ylethylamino)ethanone |
|---|---|
| PubChem CID | 112769581 |
| Molecular Formula | C22H25N3O3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-2-(1-thiophen-2-ylethylamino)ethanone |
| SMILES | CC(NCC(=O)N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1)c1cccs1 |
| InChI | InChI=1S/C22H25N3O3S2/c1-17(21-7-4-14-29-21)23-16-22(26)24-10-12-25(13-11-24)30(27,28)20-9-8-18-5-2-3-6-19(18)15-20/h2-9,14-15,17,23H,10-13,16H2,1H3 |
| InChIKey | WYAPDCNRTCODHD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |