C20H25N3O4S2 — CID 41170115
4-[4-(benzenesulfonyl)piperazin-1-yl]-4-oxo-N-[(1S)-1-thiophen-2-ylethyl]butanamide (PubChem CID 41170115) has the molecular formula C20H25N3O4S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)piperazin-1-yl]-4-oxo-N-[(1S)-1-thiophen-2-ylethyl]butanamide.
| Compound Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-4-oxo-N-[(1S)-1-thiophen-2-ylethyl]butanamide |
|---|---|
| PubChem CID | 41170115 |
| Molecular Formula | C20H25N3O4S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-4-oxo-N-[(1S)-1-thiophen-2-ylethyl]butanamide |
| SMILES | C[C@H](NC(=O)CCC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1)c1cccs1 |
| InChI | InChI=1S/C20H25N3O4S2/c1-16(18-8-5-15-28-18)21-19(24)9-10-20(25)22-11-13-23(14-12-22)29(26,27)17-6-3-2-4-7-17/h2-8,15-16H,9-14H2,1H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | NJWJOFBSBPVFSV-INIZCTEOSA-N |
| XLogP | 2.24 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |