C21H32N4O5S — CID 55948679
4-[4-(benzenesulfonyl)piperazin-1-yl]-N-[3-(butan-2-ylamino)-3-oxopropyl]-4-oxobutanamide (PubChem CID 55948679) has the molecular formula C21H32N4O5S and a molecular weight of 452.58 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)piperazin-1-yl]-N-[3-(butan-2-ylamino)-3-oxopropyl]-4-oxobutanamide.
| Compound Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-N-[3-(butan-2-ylamino)-3-oxopropyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 55948679 |
| Molecular Formula | C21H32N4O5S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-N-[3-(butan-2-ylamino)-3-oxopropyl]-4-oxobutanamide |
| SMILES | CCC(C)NC(=O)CCNC(=O)CCC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H32N4O5S/c1-3-17(2)23-20(27)11-12-22-19(26)9-10-21(28)24-13-15-25(16-14-24)31(29,30)18-7-5-4-6-8-18/h4-8,17H,3,9-16H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | OJUPGBPAXRPPSS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |