C24H38N4O4S — CID 55572982
4-[4-(benzenesulfonyl)piperazin-1-yl]-N-[3-[cyclohexyl(methyl)amino]propyl]-4-oxobutanamide (PubChem CID 55572982) has the molecular formula C24H38N4O4S and a molecular weight of 478.66 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)piperazin-1-yl]-N-[3-[cyclohexyl(methyl)amino]propyl]-4-oxobutanamide.
| Compound Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-N-[3-[cyclohexyl(methyl)amino]propyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 55572982 |
| Molecular Formula | C24H38N4O4S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 4-[4-(benzenesulfonyl)piperazin-1-yl]-N-[3-[cyclohexyl(methyl)amino]propyl]-4-oxobutanamide |
| SMILES | CN(CCCNC(=O)CCC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C24H38N4O4S/c1-26(21-9-4-2-5-10-21)16-8-15-25-23(29)13-14-24(30)27-17-19-28(20-18-27)33(31,32)22-11-6-3-7-12-22/h3,6-7,11-12,21H,2,4-5,8-10,13-20H2,1H3,(H,25,29) |
| InChIKey | NPPRTWJXEHIDEA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|