C17H25N3O3S — CID 51305589
2-oxo-N-propan-2-yl-2-[4-(4-thiophen-2-ylbutanoyl)piperazin-1-yl]acetamide (PubChem CID 51305589) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-oxo-N-propan-2-yl-2-[4-(4-thiophen-2-ylbutanoyl)piperazin-1-yl]acetamide.
| Compound Name | 2-oxo-N-propan-2-yl-2-[4-(4-thiophen-2-ylbutanoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 51305589 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-oxo-N-propan-2-yl-2-[4-(4-thiophen-2-ylbutanoyl)piperazin-1-yl]acetamide |
| SMILES | CC(C)NC(=O)C(=O)N1CCN(C(=O)CCCc2cccs2)CC1 |
| InChI | InChI=1S/C17H25N3O3S/c1-13(2)18-16(22)17(23)20-10-8-19(9-11-20)15(21)7-3-5-14-6-4-12-24-14/h4,6,12-13H,3,5,7-11H2,1-2H3,(H,18,22) |
| InChIKey | IPDSIXCLVHAHSH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|