C18H29N3O2S — CID 110420377
1-[4-[3-(dimethylamino)propanoyl]piperazin-1-yl]-5-thiophen-2-ylpentan-1-one (PubChem CID 110420377) has the molecular formula C18H29N3O2S and a molecular weight of 351.52 g/mol. Its IUPAC name is 1-[4-[3-(dimethylamino)propanoyl]piperazin-1-yl]-5-thiophen-2-ylpentan-1-one.
| Compound Name | 1-[4-[3-(dimethylamino)propanoyl]piperazin-1-yl]-5-thiophen-2-ylpentan-1-one |
|---|---|
| PubChem CID | 110420377 |
| Molecular Formula | C18H29N3O2S |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 1-[4-[3-(dimethylamino)propanoyl]piperazin-1-yl]-5-thiophen-2-ylpentan-1-one |
| SMILES | CN(C)CCC(=O)N1CCN(C(=O)CCCCc2cccs2)CC1 |
| InChI | InChI=1S/C18H29N3O2S/c1-19(2)10-9-18(23)21-13-11-20(12-14-21)17(22)8-4-3-6-16-7-5-15-24-16/h5,7,15H,3-4,6,8-14H2,1-2H3 |
| InChIKey | JQZYCSFAYAAQGQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|