C15H23BrN2OS — CID 80665416
1-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-4-thiophen-2-ylbutan-1-one (PubChem CID 80665416) has the molecular formula C15H23BrN2OS and a molecular weight of 359.33 g/mol. Its IUPAC name is 1-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 80665416 |
| Molecular Formula | C15H23BrN2OS |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 1-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-4-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCc1cccs1)N1CCCN(CCBr)CC1 |
| InChI | InChI=1S/C15H23BrN2OS/c16-7-10-17-8-3-9-18(12-11-17)15(19)6-1-4-14-5-2-13-20-14/h2,5,13H,1,3-4,6-12H2 |
| InChIKey | QDKCSZIGROFVDU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|