C12H19BrN2S — CID 80667707
1-(2-bromoethyl)-4-(thiophen-2-ylmethyl)-1,4-diazepane (PubChem CID 80667707) has the molecular formula C12H19BrN2S and a molecular weight of 303.27 g/mol. Its IUPAC name is 1-(2-bromoethyl)-4-(thiophen-2-ylmethyl)-1,4-diazepane.
| Compound Name | 1-(2-bromoethyl)-4-(thiophen-2-ylmethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 80667707 |
| Molecular Formula | C12H19BrN2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-(2-bromoethyl)-4-(thiophen-2-ylmethyl)-1,4-diazepane |
| SMILES | BrCCN1CCCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C12H19BrN2S/c13-4-7-14-5-2-6-15(9-8-14)11-12-3-1-10-16-12/h1,3,10H,2,4-9,11H2 |
| InChIKey | UQGWMYTWQFBAPK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|