C13H22N2O2S2 — CID 61383814
1-propylsulfonyl-4-(thiophen-2-ylmethyl)-1,4-diazepane (PubChem CID 61383814) has the molecular formula C13H22N2O2S2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-propylsulfonyl-4-(thiophen-2-ylmethyl)-1,4-diazepane.
| Compound Name | 1-propylsulfonyl-4-(thiophen-2-ylmethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 61383814 |
| Molecular Formula | C13H22N2O2S2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-propylsulfonyl-4-(thiophen-2-ylmethyl)-1,4-diazepane |
| SMILES | CCCS(=O)(=O)N1CCCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C13H22N2O2S2/c1-2-11-19(16,17)15-7-4-6-14(8-9-15)12-13-5-3-10-18-13/h3,5,10H,2,4,6-9,11-12H2,1H3 |
| InChIKey | IQQPTXYIZLSPCN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |