C14H24ClN3O3S2 — CID 16881362
N-[2-(4-ethylpiperazin-1-yl)sulfonylethyl]-2-thiophen-2-ylacetamide;hydrochloride (PubChem CID 16881362) has the molecular formula C14H24ClN3O3S2 and a molecular weight of 381.95 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)sulfonylethyl]-2-thiophen-2-ylacetamide;hydrochloride.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)sulfonylethyl]-2-thiophen-2-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 16881362 |
| Molecular Formula | C14H24ClN3O3S2 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)sulfonylethyl]-2-thiophen-2-ylacetamide;hydrochloride |
| SMILES | CCN1CCN(S(=O)(=O)CCNC(=O)Cc2cccs2)CC1.Cl |
| InChI | InChI=1S/C14H23N3O3S2.ClH/c1-2-16-6-8-17(9-7-16)22(19,20)11-5-15-14(18)12-13-4-3-10-21-13;/h3-4,10H,2,5-9,11-12H2,1H3,(H,15,18);1H |
| InChIKey | XTJILNNQLNUHKN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |