C15H19N3O2S2 — CID 131936945
1-pyridin-3-ylsulfonyl-4-(thiophen-2-ylmethyl)-1,4-diazepane (PubChem CID 131936945) has the molecular formula C15H19N3O2S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-pyridin-3-ylsulfonyl-4-(thiophen-2-ylmethyl)-1,4-diazepane.
| Compound Name | 1-pyridin-3-ylsulfonyl-4-(thiophen-2-ylmethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 131936945 |
| Molecular Formula | C15H19N3O2S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 1-pyridin-3-ylsulfonyl-4-(thiophen-2-ylmethyl)-1,4-diazepane |
| SMILES | O=S(=O)(c1cccnc1)N1CCCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C15H19N3O2S2/c19-22(20,15-5-1-6-16-12-15)18-8-3-7-17(9-10-18)13-14-4-2-11-21-14/h1-2,4-6,11-12H,3,7-10,13H2 |
| InChIKey | MWCRUPQQKSQFPE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |