C11H15N3O4S — CID 43521604
2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)acetic acid (PubChem CID 43521604) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)acetic acid.
| Compound Name | 2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)acetic acid |
|---|---|
| PubChem CID | 43521604 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-(4-pyridin-3-ylsulfonylpiperazin-1-yl)acetic acid |
| SMILES | O=C(O)CN1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C11H15N3O4S/c15-11(16)9-13-4-6-14(7-5-13)19(17,18)10-2-1-3-12-8-10/h1-3,8H,4-7,9H2,(H,15,16) |
| InChIKey | AAJFUWBUIANPBB-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |