C15H22N4O4S — CID 55824192
2-morpholin-4-yl-1-(4-pyridin-3-ylsulfonylpiperazin-1-yl)ethanone (PubChem CID 55824192) has the molecular formula C15H22N4O4S and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-morpholin-4-yl-1-(4-pyridin-3-ylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-morpholin-4-yl-1-(4-pyridin-3-ylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 55824192 |
| Molecular Formula | C15H22N4O4S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-morpholin-4-yl-1-(4-pyridin-3-ylsulfonylpiperazin-1-yl)ethanone |
| SMILES | O=C(CN1CCOCC1)N1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C15H22N4O4S/c20-15(13-17-8-10-23-11-9-17)18-4-6-19(7-5-18)24(21,22)14-2-1-3-16-12-14/h1-3,12H,4-11,13H2 |
| InChIKey | YUPBYFMKBNMWSN-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |