C16H27Cl2N5O3S — CID 120982459
1-piperazin-1-yl-3-(4-pyridin-3-ylsulfonylpiperazin-1-yl)propan-1-one;dihydrochloride (PubChem CID 120982459) has the molecular formula C16H27Cl2N5O3S and a molecular weight of 440.40 g/mol. Its IUPAC name is 1-piperazin-1-yl-3-(4-pyridin-3-ylsulfonylpiperazin-1-yl)propan-1-one;dihydrochloride.
| Compound Name | 1-piperazin-1-yl-3-(4-pyridin-3-ylsulfonylpiperazin-1-yl)propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120982459 |
| Molecular Formula | C16H27Cl2N5O3S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 1-piperazin-1-yl-3-(4-pyridin-3-ylsulfonylpiperazin-1-yl)propan-1-one;dihydrochloride |
| SMILES | Cl.Cl.O=C(CCN1CCN(S(=O)(=O)c2cccnc2)CC1)N1CCNCC1 |
| InChI | InChI=1S/C16H25N5O3S.2ClH/c22-16(20-8-5-17-6-9-20)3-7-19-10-12-21(13-11-19)25(23,24)15-2-1-4-18-14-15;;/h1-2,4,14,17H,3,5-13H2;2*1H |
| InChIKey | OEEQVHJUXNANFZ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |