C21H23N5O4S — CID 39226517
3-[4-oxo-4-(4-pyridin-3-ylsulfonylpiperazin-1-yl)butyl]quinazolin-4-one (PubChem CID 39226517) has the molecular formula C21H23N5O4S and a molecular weight of 441.51 g/mol. Its IUPAC name is 3-[4-oxo-4-(4-pyridin-3-ylsulfonylpiperazin-1-yl)butyl]quinazolin-4-one.
| Compound Name | 3-[4-oxo-4-(4-pyridin-3-ylsulfonylpiperazin-1-yl)butyl]quinazolin-4-one |
|---|---|
| PubChem CID | 39226517 |
| Molecular Formula | C21H23N5O4S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 3-[4-oxo-4-(4-pyridin-3-ylsulfonylpiperazin-1-yl)butyl]quinazolin-4-one |
| SMILES | O=C(CCCn1cnc2ccccc2c1=O)N1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C21H23N5O4S/c27-20(8-4-10-25-16-23-19-7-2-1-6-18(19)21(25)28)24-11-13-26(14-12-24)31(29,30)17-5-3-9-22-15-17/h1-3,5-7,9,15-16H,4,8,10-14H2 |
| InChIKey | MOBCBLCMHOPVFE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 105.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |