C24H28N4O2 — CID 4904361
3-[6-oxo-6-(4-phenylpiperazin-1-yl)hexyl]quinazolin-4-one (PubChem CID 4904361) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-[6-oxo-6-(4-phenylpiperazin-1-yl)hexyl]quinazolin-4-one.
| Compound Name | 3-[6-oxo-6-(4-phenylpiperazin-1-yl)hexyl]quinazolin-4-one |
|---|---|
| PubChem CID | 4904361 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 3-[6-oxo-6-(4-phenylpiperazin-1-yl)hexyl]quinazolin-4-one |
| SMILES | O=C(CCCCCn1cnc2ccccc2c1=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H28N4O2/c29-23(27-17-15-26(16-18-27)20-9-3-1-4-10-20)13-5-2-8-14-28-19-25-22-12-7-6-11-21(22)24(28)30/h1,3-4,6-7,9-12,19H,2,5,8,13-18H2 |
| InChIKey | IYZOHBSYWZCMAK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|