C25H31N4O2+ — CID 7632354
3-[6-(4-benzylpiperazin-4-ium-1-yl)-6-oxohexyl]quinazolin-4-one (PubChem CID 7632354) has the molecular formula C25H31N4O2+ and a molecular weight of 419.55 g/mol. Its IUPAC name is 3-[6-(4-benzylpiperazin-4-ium-1-yl)-6-oxohexyl]quinazolin-4-one.
| Compound Name | 3-[6-(4-benzylpiperazin-4-ium-1-yl)-6-oxohexyl]quinazolin-4-one |
|---|---|
| PubChem CID | 7632354 |
| Molecular Formula | C25H31N4O2+ |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 3-[6-(4-benzylpiperazin-4-ium-1-yl)-6-oxohexyl]quinazolin-4-one |
| SMILES | O=C(CCCCCn1cnc2ccccc2c1=O)N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H30N4O2/c30-24(28-17-15-27(16-18-28)19-21-9-3-1-4-10-21)13-5-2-8-14-29-20-26-23-12-7-6-11-22(23)25(29)31/h1,3-4,6-7,9-12,20H,2,5,8,13-19H2/p+1 |
| InChIKey | ZECHDJGZXVUXHZ-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|