C21H22ClN4O2+ — CID 8642933
3-[2-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]-2-oxoethyl]quinazolin-4-one (PubChem CID 8642933) has the molecular formula C21H22ClN4O2+ and a molecular weight of 397.89 g/mol. Its IUPAC name is 3-[2-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]-2-oxoethyl]quinazolin-4-one.
| Compound Name | 3-[2-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]-2-oxoethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 8642933 |
| Molecular Formula | C21H22ClN4O2+ |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 3-[2-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]-2-oxoethyl]quinazolin-4-one |
| SMILES | O=C(Cn1cnc2ccccc2c1=O)N1CC[NH+](Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H21ClN4O2/c22-17-5-3-4-16(12-17)13-24-8-10-25(11-9-24)20(27)14-26-15-23-19-7-2-1-6-18(19)21(26)28/h1-7,12,15H,8-11,13-14H2/p+1 |
| InChIKey | FRWMNBGUSMUHKF-UHFFFAOYSA-O |
| XLogP | 0.98 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |