C20H28N5O3+ — CID 8671777
N-tert-butyl-2-[4-[2-(4-oxoquinazolin-3-yl)acetyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 8671777) has the molecular formula C20H28N5O3+ and a molecular weight of 386.48 g/mol. Its IUPAC name is N-tert-butyl-2-[4-[2-(4-oxoquinazolin-3-yl)acetyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-tert-butyl-2-[4-[2-(4-oxoquinazolin-3-yl)acetyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8671777 |
| Molecular Formula | C20H28N5O3+ |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-tert-butyl-2-[4-[2-(4-oxoquinazolin-3-yl)acetyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)C[NH+]1CCN(C(=O)Cn2cnc3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C20H27N5O3/c1-20(2,3)22-17(26)12-23-8-10-24(11-9-23)18(27)13-25-14-21-16-7-5-4-6-15(16)19(25)28/h4-7,14H,8-13H2,1-3H3,(H,22,26)/p+1 |
| InChIKey | FBZUONJLRJXGFO-UHFFFAOYSA-O |
| XLogP | -0.96 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |