C18H24N4O3 — CID 56803097
3-[2-[4-(2-hydroxybutyl)piperazin-1-yl]-2-oxoethyl]quinazolin-4-one (PubChem CID 56803097) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-[2-[4-(2-hydroxybutyl)piperazin-1-yl]-2-oxoethyl]quinazolin-4-one.
| Compound Name | 3-[2-[4-(2-hydroxybutyl)piperazin-1-yl]-2-oxoethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 56803097 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-[2-[4-(2-hydroxybutyl)piperazin-1-yl]-2-oxoethyl]quinazolin-4-one |
| SMILES | CCC(O)CN1CCN(C(=O)Cn2cnc3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C18H24N4O3/c1-2-14(23)11-20-7-9-21(10-8-20)17(24)12-22-13-19-16-6-4-3-5-15(16)18(22)25/h3-6,13-14,23H,2,7-12H2,1H3 |
| InChIKey | XKGSEAGCUUMFPC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |