C25H23FN4O2 — CID 39005053
7-fluoro-3-[2-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-oxoethyl]quinazolin-4-one (PubChem CID 39005053) has the molecular formula C25H23FN4O2 and a molecular weight of 430.48 g/mol. Its IUPAC name is 7-fluoro-3-[2-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-oxoethyl]quinazolin-4-one.
| Compound Name | 7-fluoro-3-[2-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-oxoethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 39005053 |
| Molecular Formula | C25H23FN4O2 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 7-fluoro-3-[2-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-2-oxoethyl]quinazolin-4-one |
| SMILES | O=C(Cn1cnc2cc(F)ccc2c1=O)N1CCN(Cc2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C25H23FN4O2/c26-20-8-9-22-23(14-20)27-17-30(25(22)32)16-24(31)29-12-10-28(11-13-29)15-19-6-3-5-18-4-1-2-7-21(18)19/h1-9,14,17H,10-13,15-16H2 |
| InChIKey | KBZLGEOXXDLYOI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |