C19H19FN4O2S — CID 39005436
7-fluoro-3-[2-oxo-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethyl]quinazolin-4-one (PubChem CID 39005436) has the molecular formula C19H19FN4O2S and a molecular weight of 386.45 g/mol. Its IUPAC name is 7-fluoro-3-[2-oxo-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethyl]quinazolin-4-one.
| Compound Name | 7-fluoro-3-[2-oxo-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 39005436 |
| Molecular Formula | C19H19FN4O2S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 7-fluoro-3-[2-oxo-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethyl]quinazolin-4-one |
| SMILES | O=C(Cn1cnc2cc(F)ccc2c1=O)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C19H19FN4O2S/c20-14-3-4-16-17(10-14)21-13-24(19(16)26)12-18(25)23-7-5-22(6-8-23)11-15-2-1-9-27-15/h1-4,9-10,13H,5-8,11-12H2 |
| InChIKey | AVGHGKJPXNVSPY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |