C18H16FN3O2S — CID 27282781
2-(7-fluoro-4-oxoquinazolin-3-yl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 27282781) has the molecular formula C18H16FN3O2S and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-(7-fluoro-4-oxoquinazolin-3-yl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(7-fluoro-4-oxoquinazolin-3-yl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 27282781 |
| Molecular Formula | C18H16FN3O2S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-(7-fluoro-4-oxoquinazolin-3-yl)-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)Cn1cnc2cc(F)ccc2c1=O |
| InChI | InChI=1S/C18H16FN3O2S/c1-2-7-21(10-14-4-3-8-25-14)17(23)11-22-12-20-16-9-13(19)5-6-15(16)18(22)24/h2-6,8-9,12H,1,7,10-11H2 |
| InChIKey | RLMYPPJDINRFKD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|