C19H19N3O2S2 — CID 18193542
2-(3-methyl-4-oxoquinazolin-2-yl)sulfanyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 18193542) has the molecular formula C19H19N3O2S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-(3-methyl-4-oxoquinazolin-2-yl)sulfanyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(3-methyl-4-oxoquinazolin-2-yl)sulfanyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 18193542 |
| Molecular Formula | C19H19N3O2S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-(3-methyl-4-oxoquinazolin-2-yl)sulfanyl-N-prop-2-enyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)CSc1nc2ccccc2c(=O)n1C |
| InChI | InChI=1S/C19H19N3O2S2/c1-3-10-22(12-14-7-6-11-25-14)17(23)13-26-19-20-16-9-5-4-8-15(16)18(24)21(19)2/h3-9,11H,1,10,12-13H2,2H3 |
| InChIKey | UKPYFMDCPVUQHD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|