C18H19N3O2S2 — CID 7876150
2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-methyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 7876150) has the molecular formula C18H19N3O2S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-methyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-methyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 7876150 |
| Molecular Formula | C18H19N3O2S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-(3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-methyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCn1c(SCC(=O)N(C)Cc2cccs2)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H19N3O2S2/c1-3-21-17(23)14-8-4-5-9-15(14)19-18(21)25-12-16(22)20(2)11-13-7-6-10-24-13/h4-10H,3,11-12H2,1-2H3 |
| InChIKey | BDNARMDZOMHWLY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |