C21H24ClN3O2S2 — CID 31458869
2-(7-chloro-4-oxo-3-pentylquinazolin-2-yl)sulfanyl-N-methyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 31458869) has the molecular formula C21H24ClN3O2S2 and a molecular weight of 450.03 g/mol. Its IUPAC name is 2-(7-chloro-4-oxo-3-pentylquinazolin-2-yl)sulfanyl-N-methyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(7-chloro-4-oxo-3-pentylquinazolin-2-yl)sulfanyl-N-methyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 31458869 |
| Molecular Formula | C21H24ClN3O2S2 |
| Molecular Weight | 450.03 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 2-(7-chloro-4-oxo-3-pentylquinazolin-2-yl)sulfanyl-N-methyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CCCCCn1c(SCC(=O)N(C)Cc2cccs2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C21H24ClN3O2S2/c1-3-4-5-10-25-20(27)17-9-8-15(22)12-18(17)23-21(25)29-14-19(26)24(2)13-16-7-6-11-28-16/h6-9,11-12H,3-5,10,13-14H2,1-2H3 |
| InChIKey | JQSAHARRWXFCKZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.03 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|