C21H22ClN3O2S — CID 7738199
2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-ethyl-N-phenylacetamide (PubChem CID 7738199) has the molecular formula C21H22ClN3O2S and a molecular weight of 415.95 g/mol. Its IUPAC name is 2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-ethyl-N-phenylacetamide.
| Compound Name | 2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-ethyl-N-phenylacetamide |
|---|---|
| PubChem CID | 7738199 |
| Molecular Formula | C21H22ClN3O2S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-(7-chloro-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-ethyl-N-phenylacetamide |
| SMILES | CCCn1c(SCC(=O)N(CC)c2ccccc2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C21H22ClN3O2S/c1-3-12-25-20(27)17-11-10-15(22)13-18(17)23-21(25)28-14-19(26)24(4-2)16-8-6-5-7-9-16/h5-11,13H,3-4,12,14H2,1-2H3 |
| InChIKey | VFBGDWNVAPJWNF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |