C19H26ClN3O2S — CID 112777902
2-(7-chloro-4-oxo-3-pentylquinazolin-2-yl)sulfanyl-N,N-diethylacetamide (PubChem CID 112777902) has the molecular formula C19H26ClN3O2S and a molecular weight of 395.96 g/mol. Its IUPAC name is 2-(7-chloro-4-oxo-3-pentylquinazolin-2-yl)sulfanyl-N,N-diethylacetamide.
| Compound Name | 2-(7-chloro-4-oxo-3-pentylquinazolin-2-yl)sulfanyl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 112777902 |
| Molecular Formula | C19H26ClN3O2S |
| Molecular Weight | 395.96 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2-(7-chloro-4-oxo-3-pentylquinazolin-2-yl)sulfanyl-N,N-diethylacetamide |
| SMILES | CCCCCn1c(SCC(=O)N(CC)CC)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C19H26ClN3O2S/c1-4-7-8-11-23-18(25)15-10-9-14(20)12-16(15)21-19(23)26-13-17(24)22(5-2)6-3/h9-10,12H,4-8,11,13H2,1-3H3 |
| InChIKey | NTNIMAQCMSEHMB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.96 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|