C20H28ClN3O3S — CID 55309371
2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N,N-diethylacetamide (PubChem CID 55309371) has the molecular formula C20H28ClN3O3S and a molecular weight of 425.98 g/mol. Its IUPAC name is 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N,N-diethylacetamide.
| Compound Name | 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 55309371 |
| Molecular Formula | C20H28ClN3O3S |
| Molecular Weight | 425.98 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1nc2cc(Cl)ccc2c(=O)n1CCCOC(C)C |
| InChI | InChI=1S/C20H28ClN3O3S/c1-5-23(6-2)18(25)13-28-20-22-17-12-15(21)8-9-16(17)19(26)24(20)10-7-11-27-14(3)4/h8-9,12,14H,5-7,10-11,13H2,1-4H3 |
| InChIKey | OLRRDKSIGAYJRB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.98 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|