C20H28ClN3O3S — CID 2491173
N-tert-butyl-2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide (PubChem CID 2491173) has the molecular formula C20H28ClN3O3S and a molecular weight of 425.98 g/mol. Its IUPAC name is N-tert-butyl-2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-tert-butyl-2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 2491173 |
| Molecular Formula | C20H28ClN3O3S |
| Molecular Weight | 425.98 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-tert-butyl-2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetamide |
| SMILES | CC(C)OCCCn1c(SCC(=O)NC(C)(C)C)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H28ClN3O3S/c1-13(2)27-10-6-9-24-18(26)15-8-7-14(21)11-16(15)22-19(24)28-12-17(25)23-20(3,4)5/h7-8,11,13H,6,9-10,12H2,1-5H3,(H,23,25) |
| InChIKey | XODSVWMSDGOJPE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.98 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|