C17H21ClN2O2S — CID 112776366
7-chloro-3-(3-propan-2-yloxypropyl)-2-prop-2-enylsulfanylquinazolin-4-one (PubChem CID 112776366) has the molecular formula C17H21ClN2O2S and a molecular weight of 352.89 g/mol. Its IUPAC name is 7-chloro-3-(3-propan-2-yloxypropyl)-2-prop-2-enylsulfanylquinazolin-4-one.
| Compound Name | 7-chloro-3-(3-propan-2-yloxypropyl)-2-prop-2-enylsulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 112776366 |
| Molecular Formula | C17H21ClN2O2S |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 7-chloro-3-(3-propan-2-yloxypropyl)-2-prop-2-enylsulfanylquinazolin-4-one |
| SMILES | C=CCSc1nc2cc(Cl)ccc2c(=O)n1CCCOC(C)C |
| InChI | InChI=1S/C17H21ClN2O2S/c1-4-10-23-17-19-15-11-13(18)6-7-14(15)16(21)20(17)8-5-9-22-12(2)3/h4,6-7,11-12H,1,5,8-10H2,2-3H3 |
| InChIKey | BFANXLBOMSIVBN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|