C18H23ClN4O4S — CID 2491185
2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-(methylcarbamoyl)acetamide (PubChem CID 2491185) has the molecular formula C18H23ClN4O4S and a molecular weight of 426.93 g/mol. Its IUPAC name is 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-(methylcarbamoyl)acetamide.
| Compound Name | 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-(methylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 2491185 |
| Molecular Formula | C18H23ClN4O4S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-(methylcarbamoyl)acetamide |
| SMILES | CNC(=O)NC(=O)CSc1nc2cc(Cl)ccc2c(=O)n1CCCOC(C)C |
| InChI | InChI=1S/C18H23ClN4O4S/c1-11(2)27-8-4-7-23-16(25)13-6-5-12(19)9-14(13)21-18(23)28-10-15(24)22-17(26)20-3/h5-6,9,11H,4,7-8,10H2,1-3H3,(H2,20,22,24,26) |
| InChIKey | KPLDSFLRMZSRLQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|