C22H24Cl2N4O3S — CID 42981848
2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-(5-chloro-2-pyridinyl)propanamide (PubChem CID 42981848) has the molecular formula C22H24Cl2N4O3S and a molecular weight of 495.43 g/mol. Its IUPAC name is 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-(5-chloro-2-pyridinyl)propanamide.
| Compound Name | 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-(5-chloro-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 42981848 |
| Molecular Formula | C22H24Cl2N4O3S |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-(5-chloro-2-pyridinyl)propanamide |
| SMILES | CC(C)OCCCn1c(SC(C)C(=O)Nc2ccc(Cl)cn2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C22H24Cl2N4O3S/c1-13(2)31-10-4-9-28-21(30)17-7-5-15(23)11-18(17)26-22(28)32-14(3)20(29)27-19-8-6-16(24)12-25-19/h5-8,11-14H,4,9-10H2,1-3H3,(H,25,27,29) |
| InChIKey | AGRJGOXEZCDDMQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|