C21H30ClN3O4S — CID 55524048
2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-(3-methoxypropyl)propanamide (PubChem CID 55524048) has the molecular formula C21H30ClN3O4S and a molecular weight of 456.01 g/mol. Its IUPAC name is 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 55524048 |
| Molecular Formula | C21H30ClN3O4S |
| Molecular Weight | 456.01 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 2-[7-chloro-4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanyl-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C(C)Sc1nc2cc(Cl)ccc2c(=O)n1CCCOC(C)C |
| InChI | InChI=1S/C21H30ClN3O4S/c1-14(2)29-12-6-10-25-20(27)17-8-7-16(22)13-18(17)24-21(25)30-15(3)19(26)23-9-5-11-28-4/h7-8,13-15H,5-6,9-12H2,1-4H3,(H,23,26) |
| InChIKey | DMGHNGXVTZIDRY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.01 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|