C17H22ClN3O3S — CID 46622053
2-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-propylpropanamide (PubChem CID 46622053) has the molecular formula C17H22ClN3O3S and a molecular weight of 383.90 g/mol. Its IUPAC name is 2-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-propylpropanamide.
| Compound Name | 2-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-propylpropanamide |
|---|---|
| PubChem CID | 46622053 |
| Molecular Formula | C17H22ClN3O3S |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)Sc1nc2cc(Cl)ccc2c(=O)n1CCOC |
| InChI | InChI=1S/C17H22ClN3O3S/c1-4-7-19-15(22)11(2)25-17-20-14-10-12(18)5-6-13(14)16(23)21(17)8-9-24-3/h5-6,10-11H,4,7-9H2,1-3H3,(H,19,22) |
| InChIKey | URQSROOBRDAOAY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |