C15H16ClN3O2S — CID 7798464
(2R)-2-[7-chloro-3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylpropanenitrile (PubChem CID 7798464) has the molecular formula C15H16ClN3O2S and a molecular weight of 337.83 g/mol. Its IUPAC name is (2R)-2-[7-chloro-3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylpropanenitrile.
| Compound Name | (2R)-2-[7-chloro-3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylpropanenitrile |
|---|---|
| PubChem CID | 7798464 |
| Molecular Formula | C15H16ClN3O2S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (2R)-2-[7-chloro-3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanylpropanenitrile |
| SMILES | COCCCn1c(S[C@H](C)C#N)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C15H16ClN3O2S/c1-10(9-17)22-15-18-13-8-11(16)4-5-12(13)14(20)19(15)6-3-7-21-2/h4-5,8,10H,3,6-7H2,1-2H3/t10-/m1/s1 |
| InChIKey | GGMCRLFAUAEAGN-SNVBAGLBSA-N |
| XLogP | 3.09 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|