C20H25ClN4O3S — CID 42946182
2-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-7-chloro-3-(3-methoxypropyl)quinazolin-4-one (PubChem CID 42946182) has the molecular formula C20H25ClN4O3S and a molecular weight of 436.97 g/mol. Its IUPAC name is 2-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-7-chloro-3-(3-methoxypropyl)quinazolin-4-one.
| Compound Name | 2-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-7-chloro-3-(3-methoxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 42946182 |
| Molecular Formula | C20H25ClN4O3S |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-7-chloro-3-(3-methoxypropyl)quinazolin-4-one |
| SMILES | COCCCn1c(SC(C)c2nc(C(C)(C)C)no2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H25ClN4O3S/c1-12(16-23-18(24-28-16)20(2,3)4)29-19-22-15-11-13(21)7-8-14(15)17(26)25(19)9-6-10-27-5/h7-8,11-12H,6,9-10H2,1-5H3 |
| InChIKey | KSWIXLXSQNDORO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|