C22H21ClN4O3S — CID 55386217
7-chloro-3-(3-methoxypropyl)-2-[1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylsulfanyl]quinazolin-4-one (PubChem CID 55386217) has the molecular formula C22H21ClN4O3S and a molecular weight of 456.96 g/mol. Its IUPAC name is 7-chloro-3-(3-methoxypropyl)-2-[1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylsulfanyl]quinazolin-4-one.
| Compound Name | 7-chloro-3-(3-methoxypropyl)-2-[1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 55386217 |
| Molecular Formula | C22H21ClN4O3S |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 7-chloro-3-(3-methoxypropyl)-2-[1-(5-phenyl-1,3,4-oxadiazol-2-yl)ethylsulfanyl]quinazolin-4-one |
| SMILES | COCCCn1c(SC(C)c2nnc(-c3ccccc3)o2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C22H21ClN4O3S/c1-14(19-25-26-20(30-19)15-7-4-3-5-8-15)31-22-24-18-13-16(23)9-10-17(18)21(28)27(22)11-6-12-29-2/h3-5,7-10,13-14H,6,11-12H2,1-2H3 |
| InChIKey | KUDLXGOIMUZNQQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|