C23H23ClN4O3S — CID 30110365
2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one (PubChem CID 30110365) has the molecular formula C23H23ClN4O3S and a molecular weight of 470.98 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one.
| Compound Name | 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 30110365 |
| Molecular Formula | C23H23ClN4O3S |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one |
| SMILES | CC(C)OCCCn1c(SCc2nnc(-c3ccc(Cl)cc3)o2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H23ClN4O3S/c1-15(2)30-13-5-12-28-22(29)18-6-3-4-7-19(18)25-23(28)32-14-20-26-27-21(31-20)16-8-10-17(24)11-9-16/h3-4,6-11,15H,5,12-14H2,1-2H3 |
| InChIKey | BUANMRJADPEBDC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|