C25H26N2O4S — CID 16510488
2-[(7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one (PubChem CID 16510488) has the molecular formula C25H26N2O4S and a molecular weight of 450.56 g/mol. Its IUPAC name is 2-[(7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one.
| Compound Name | 2-[(7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 16510488 |
| Molecular Formula | C25H26N2O4S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 2-[(7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-(3-propan-2-yloxypropyl)quinazolin-4-one |
| SMILES | Cc1ccc2c(CSc3nc4ccccc4c(=O)n3CCCOC(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H26N2O4S/c1-16(2)30-12-6-11-27-24(29)20-7-4-5-8-21(20)26-25(27)32-15-18-14-23(28)31-22-13-17(3)9-10-19(18)22/h4-5,7-10,13-14,16H,6,11-12,15H2,1-3H3 |
| InChIKey | NAEVCUQCVWEHAM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|