C22H19ClN2O4S — CID 31197062
2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-(3-hydroxypropyl)quinazolin-4-one (PubChem CID 31197062) has the molecular formula C22H19ClN2O4S and a molecular weight of 442.92 g/mol. Its IUPAC name is 2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-(3-hydroxypropyl)quinazolin-4-one.
| Compound Name | 2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-(3-hydroxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 31197062 |
| Molecular Formula | C22H19ClN2O4S |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-(3-hydroxypropyl)quinazolin-4-one |
| SMILES | Cc1cc2oc(=O)cc(CSc3nc4ccccc4c(=O)n3CCCO)c2cc1Cl |
| InChI | InChI=1S/C22H19ClN2O4S/c1-13-9-19-16(11-17(13)23)14(10-20(27)29-19)12-30-22-24-18-6-3-2-5-15(18)21(28)25(22)7-4-8-26/h2-3,5-6,9-11,26H,4,7-8,12H2,1H3 |
| InChIKey | LLPZRFZHDXFWGO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|