C19H13ClN2O3S — CID 135486528
2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3H-quinazolin-4-one (PubChem CID 135486528) has the molecular formula C19H13ClN2O3S and a molecular weight of 384.84 g/mol. Its IUPAC name is 2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135486528 |
| Molecular Formula | C19H13ClN2O3S |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3H-quinazolin-4-one |
| SMILES | Cc1cc2oc(=O)cc(CSc3nc4ccccc4c(=O)[nH]3)c2cc1Cl |
| InChI | InChI=1S/C19H13ClN2O3S/c1-10-6-16-13(8-14(10)20)11(7-17(23)25-16)9-26-19-21-15-5-3-2-4-12(15)18(24)22-19/h2-8H,9H2,1H3,(H,21,22,24) |
| InChIKey | KYMXOILAAPBFKE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|