C22H15ClN2O2S — CID 135723541
2-[[4-(2-chlorobenzoyl)phenyl]methylsulfanyl]-3H-quinazolin-4-one (PubChem CID 135723541) has the molecular formula C22H15ClN2O2S and a molecular weight of 406.89 g/mol. Its IUPAC name is 2-[[4-(2-chlorobenzoyl)phenyl]methylsulfanyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[4-(2-chlorobenzoyl)phenyl]methylsulfanyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135723541 |
| Molecular Formula | C22H15ClN2O2S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 2-[[4-(2-chlorobenzoyl)phenyl]methylsulfanyl]-3H-quinazolin-4-one |
| SMILES | O=C(c1ccc(CSc2nc3ccccc3c(=O)[nH]2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C22H15ClN2O2S/c23-18-7-3-1-5-16(18)20(26)15-11-9-14(10-12-15)13-28-22-24-19-8-4-2-6-17(19)21(27)25-22/h1-12H,13H2,(H,24,25,27) |
| InChIKey | TUCUSRGWUHVOAV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |