C24H21ClNO2+ — CID 7516039
benzhydryl-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]azanium (PubChem CID 7516039) has the molecular formula C24H21ClNO2+ and a molecular weight of 390.89 g/mol. Its IUPAC name is benzhydryl-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]azanium.
| Compound Name | benzhydryl-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 7516039 |
| Molecular Formula | C24H21ClNO2+ |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | benzhydryl-[(6-chloro-7-methyl-2-oxochromen-4-yl)methyl]azanium |
| SMILES | Cc1cc2oc(=O)cc(C[NH2+]C(c3ccccc3)c3ccccc3)c2cc1Cl |
| InChI | InChI=1S/C24H20ClNO2/c1-16-12-22-20(14-21(16)25)19(13-23(27)28-22)15-26-24(17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-14,24,26H,15H2,1H3/p+1 |
| InChIKey | XHCFGSQHIBWIMV-UHFFFAOYSA-O |
| XLogP | 4.61 |
| TPSA | 46.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|