C25H32N2O3+2 — CID 9266043
(6,7-dimethyl-2-oxochromen-4-yl)methyl-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]azanium (PubChem CID 9266043) has the molecular formula C25H32N2O3+2 and a molecular weight of 408.54 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]azanium.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 9266043 |
| Molecular Formula | C25H32N2O3+2 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(1S,2R)-1-morpholin-4-ium-4-yl-1-phenylpropan-2-yl]azanium |
| SMILES | Cc1cc2oc(=O)cc(C[NH2+][C@H](C)[C@H](c3ccccc3)[NH+]3CCOCC3)c2cc1C |
| InChI | InChI=1S/C25H30N2O3/c1-17-13-22-21(15-24(28)30-23(22)14-18(17)2)16-26-19(3)25(20-7-5-4-6-8-20)27-9-11-29-12-10-27/h4-8,13-15,19,25-26H,9-12,16H2,1-3H3/p+2/t19-,25-/m1/s1 |
| InChIKey | LINGTYOBZHDOOZ-KBMIEXCESA-P |
| XLogP | 1.52 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|