C20H24NO2S+ — CID 9134835
(6,7-dimethyl-2-oxochromen-4-yl)methyl-[(1S)-2-methyl-1-thiophen-2-ylpropyl]azanium (PubChem CID 9134835) has the molecular formula C20H24NO2S+ and a molecular weight of 342.48 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(1S)-2-methyl-1-thiophen-2-ylpropyl]azanium.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(1S)-2-methyl-1-thiophen-2-ylpropyl]azanium |
|---|---|
| PubChem CID | 9134835 |
| Molecular Formula | C20H24NO2S+ |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(1S)-2-methyl-1-thiophen-2-ylpropyl]azanium |
| SMILES | Cc1cc2oc(=O)cc(C[NH2+][C@H](c3cccs3)C(C)C)c2cc1C |
| InChI | InChI=1S/C20H23NO2S/c1-12(2)20(18-6-5-7-24-18)21-11-15-10-19(22)23-17-9-14(4)13(3)8-16(15)17/h5-10,12,20-21H,11H2,1-4H3/p+1/t20-/m0/s1 |
| InChIKey | DPJIVZHBXVDPBC-FQEVSTJZSA-O |
| XLogP | 3.93 |
| TPSA | 46.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|