C22H25FNO2+ — CID 9133852
(6,7-dimethyl-2-oxochromen-4-yl)methyl-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium (PubChem CID 9133852) has the molecular formula C22H25FNO2+ and a molecular weight of 354.45 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium |
|---|---|
| PubChem CID | 9133852 |
| Molecular Formula | C22H25FNO2+ |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl-[(1R)-1-(4-fluorophenyl)-2-methylpropyl]azanium |
| SMILES | Cc1cc2oc(=O)cc(C[NH2+][C@@H](c3ccc(F)cc3)C(C)C)c2cc1C |
| InChI | InChI=1S/C22H24FNO2/c1-13(2)22(16-5-7-18(23)8-6-16)24-12-17-11-21(25)26-20-10-15(4)14(3)9-19(17)20/h5-11,13,22,24H,12H2,1-4H3/p+1/t22-/m1/s1 |
| InChIKey | WCQRQGDAJGIPBU-JOCHJYFZSA-O |
| XLogP | 4.01 |
| TPSA | 46.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|